C38H43N4O2+ — CID 23787717
N-(2-aminoethyl)-6-[5-anilino-3,3-dimethyl-2-[(E)-2-(4-phenoxyphenyl)ethenyl]indol-1-ium-1-yl]hexanamide (PubChem CID 23787717) has the molecular formula C38H43N4O2+ and a molecular weight of 587.79 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[5-anilino-3,3-dimethyl-2-[(E)-2-(4-phenoxyphenyl)ethenyl]indol-1-ium-1-yl]hexanamide.
| Compound Name | N-(2-aminoethyl)-6-[5-anilino-3,3-dimethyl-2-[(E)-2-(4-phenoxyphenyl)ethenyl]indol-1-ium-1-yl]hexanamide |
|---|---|
| PubChem CID | 23787717 |
| Molecular Formula | C38H43N4O2+ |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.34 |
| IUPAC Name | N-(2-aminoethyl)-6-[5-anilino-3,3-dimethyl-2-[(E)-2-(4-phenoxyphenyl)ethenyl]indol-1-ium-1-yl]hexanamide |
| SMILES | CC1(C)C(/C=C/c2ccc(Oc3ccccc3)cc2)=[N+](CCCCCC(=O)NCCN)c2ccc(Nc3ccccc3)cc21 |
| InChI | InChI=1S/C38H42N4O2/c1-38(2)34-28-31(41-30-12-6-3-7-13-30)20-23-35(34)42(27-11-5-10-16-37(43)40-26-25-39)36(38)24-19-29-17-21-33(22-18-29)44-32-14-8-4-9-15-32/h3-4,6-9,12-15,17-24,28,41H,5,10-11,16,25-27,39H2,1-2H3/p+1/b24-19+ |
| InChIKey | XHRWWCZLVOZIDH-LYBHJNIJSA-O |
| XLogP | 7.95 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|