C30H33Cl2N4O2+ — CID 23758562
N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(4-phenoxyphenyl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide (PubChem CID 23758562) has the molecular formula C30H33Cl2N4O2+ and a molecular weight of 552.53 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(4-phenoxyphenyl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide.
| Compound Name | N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(4-phenoxyphenyl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide |
|---|---|
| PubChem CID | 23758562 |
| Molecular Formula | C30H33Cl2N4O2+ |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(4-phenoxyphenyl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide |
| SMILES | C[n+]1c(/C=C/c2ccc(Oc3ccccc3)cc2)n(CCCCCC(=O)NCCN)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C30H32Cl2N4O2/c1-35-27-20-25(31)26(32)21-28(27)36(19-7-3-6-10-29(37)34-18-17-33)30(35)16-13-22-11-14-24(15-12-22)38-23-8-4-2-5-9-23/h2,4-5,8-9,11-16,20-21H,3,6-7,10,17-19,33H2,1H3/p+1/b16-13+ |
| InChIKey | OEPHBNYLFGDNRA-DTQAZKPQSA-O |
| XLogP | 6.37 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|