C27H32Cl2N5O+ — CID 135549300
N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(1-methylindol-3-yl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide (PubChem CID 135549300) has the molecular formula C27H32Cl2N5O+ and a molecular weight of 513.49 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(1-methylindol-3-yl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide.
| Compound Name | N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(1-methylindol-3-yl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide |
|---|---|
| PubChem CID | 135549300 |
| Molecular Formula | C27H32Cl2N5O+ |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(1-methylindol-3-yl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide |
| SMILES | Cn1cc(/C=C/c2n(CCCCCC(=O)NCCN)c3cc(Cl)c(Cl)cc3[n+]2C)c2ccccc21 |
| InChI | InChI=1S/C27H31Cl2N5O/c1-32-18-19(20-8-5-6-9-23(20)32)11-12-27-33(2)24-16-21(28)22(29)17-25(24)34(27)15-7-3-4-10-26(35)31-14-13-30/h5-6,8-9,11-12,16-18H,3-4,7,10,13-15,30H2,1-2H3/p+1 |
| InChIKey | LGZLAFVJVPEBKR-UHFFFAOYSA-O |
| XLogP | 5.07 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|