C29H29N4+ — CID 23758805
2-[2,6-bis[(E)-2-(1-methylindol-3-yl)ethenyl]pyridin-1-ium-1-yl]ethanamine (PubChem CID 23758805) has the molecular formula C29H29N4+ and a molecular weight of 433.58 g/mol. Its IUPAC name is 2-[2,6-bis[(E)-2-(1-methylindol-3-yl)ethenyl]pyridin-1-ium-1-yl]ethanamine.
| Compound Name | 2-[2,6-bis[(E)-2-(1-methylindol-3-yl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 23758805 |
| Molecular Formula | C29H29N4+ |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[2,6-bis[(E)-2-(1-methylindol-3-yl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
| SMILES | Cn1cc(/C=C/c2cccc(/C=C/c3cn(C)c4ccccc34)[n+]2CCN)c2ccccc21 |
| InChI | InChI=1S/C29H29N4/c1-31-20-22(26-10-3-5-12-28(26)31)14-16-24-8-7-9-25(33(24)19-18-30)17-15-23-21-32(2)29-13-6-4-11-27(23)29/h3-17,20-21H,18-19,30H2,1-2H3/q+1 |
| InChIKey | KNPPZMSUWLRLAO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 39.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|