C19H19NO2 — CID 44516239
3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole (PubChem CID 44516239) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole.
| Compound Name | 3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole |
|---|---|
| PubChem CID | 44516239 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole |
| SMILES | COc1cc(/C=C/c2cn(C)c3ccccc23)cc(OC)c1 |
| InChI | InChI=1S/C19H19NO2/c1-20-13-15(18-6-4-5-7-19(18)20)9-8-14-10-16(21-2)12-17(11-14)22-3/h4-13H,1-3H3/b9-8+ |
| InChIKey | BUHRDJOFDBKRGE-CMDGGOBGSA-N |
| XLogP | 4.37 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |