C29H33Cl2N4O+ — CID 23816576
N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(4-methylnaphthalen-1-yl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide (PubChem CID 23816576) has the molecular formula C29H33Cl2N4O+ and a molecular weight of 524.52 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(4-methylnaphthalen-1-yl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide.
| Compound Name | N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(4-methylnaphthalen-1-yl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide |
|---|---|
| PubChem CID | 23816576 |
| Molecular Formula | C29H33Cl2N4O+ |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | N-(2-aminoethyl)-6-[5,6-dichloro-3-methyl-2-[(E)-2-(4-methylnaphthalen-1-yl)ethenyl]benzimidazol-3-ium-1-yl]hexanamide |
| SMILES | Cc1ccc(/C=C/c2n(CCCCCC(=O)NCCN)c3cc(Cl)c(Cl)cc3[n+]2C)c2ccccc12 |
| InChI | InChI=1S/C29H32Cl2N4O/c1-20-11-12-21(23-9-6-5-8-22(20)23)13-14-29-34(2)26-18-24(30)25(31)19-27(26)35(29)17-7-3-4-10-28(36)33-16-15-32/h5-6,8-9,11-14,18-19H,3-4,7,10,15-17,32H2,1-2H3/p+1/b14-13+ |
| InChIKey | CAWRLWQKDCOOPT-BUHFOSPRSA-O |
| XLogP | 6.04 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|