C28H36N3O+ — CID 23816615
N-(2-aminoethyl)-6-[2-[(E)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium-1-yl]hexanamide (PubChem CID 23816615) has the molecular formula C28H36N3O+ and a molecular weight of 430.62 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[2-[(E)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium-1-yl]hexanamide.
| Compound Name | N-(2-aminoethyl)-6-[2-[(E)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium-1-yl]hexanamide |
|---|---|
| PubChem CID | 23816615 |
| Molecular Formula | C28H36N3O+ |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | N-(2-aminoethyl)-6-[2-[(E)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium-1-yl]hexanamide |
| SMILES | Cc1cc(C)c(/C=C/c2ccc3ccccc3[n+]2CCCCCC(=O)NCCN)c(C)c1 |
| InChI | InChI=1S/C28H35N3O/c1-21-19-22(2)26(23(3)20-21)15-14-25-13-12-24-9-6-7-10-27(24)31(25)18-8-4-5-11-28(32)30-17-16-29/h6-7,9-10,12-15,19-20H,4-5,8,11,16-18,29H2,1-3H3/p+1/b15-14+ |
| InChIKey | DERWCAYCJCPAKA-CCEZHUSRSA-O |
| XLogP | 4.86 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|