C26H23N2O+ — CID 72707502
3-[2-[(E)-2-(9H-carbazol-3-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-ol (PubChem CID 72707502) has the molecular formula C26H23N2O+ and a molecular weight of 379.48 g/mol. Its IUPAC name is 3-[2-[(E)-2-(9H-carbazol-3-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-ol.
| Compound Name | 3-[2-[(E)-2-(9H-carbazol-3-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 72707502 |
| Molecular Formula | C26H23N2O+ |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-[2-[(E)-2-(9H-carbazol-3-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-ol |
| SMILES | OCCC[n+]1c(/C=C/c2ccc3[nH]c4ccccc4c3c2)ccc2ccccc21 |
| InChI | InChI=1S/C26H22N2O/c29-17-5-16-28-21(14-12-20-6-1-4-9-26(20)28)13-10-19-11-15-25-23(18-19)22-7-2-3-8-24(22)27-25/h1-4,6-15,18,29H,5,16-17H2/p+1 |
| InChIKey | CMXYGRXQPUUMEY-UHFFFAOYSA-O |
| XLogP | 5.31 |
| TPSA | 39.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|