C20H13N — CID 90238864
10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene (PubChem CID 90238864) has the molecular formula C20H13N and a molecular weight of 267.33 g/mol. Its IUPAC name is 10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene.
| Compound Name | 10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 90238864 |
| Molecular Formula | C20H13N |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene |
| SMILES | c1ccc2c(c1)ccc1cc3[nH]c4ccccc4c3cc12 |
| InChI | InChI=1S/C20H13N/c1-2-6-15-13(5-1)9-10-14-11-20-18(12-17(14)15)16-7-3-4-8-19(16)21-20/h1-12,21H |
| InChIKey | DUWWKELAKUEGEW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|