C20H20NO3S+ — CID 4548738
3-[2-(2-phenylethenyl)quinolin-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 4548738) has the molecular formula C20H20NO3S+ and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-[2-(2-phenylethenyl)quinolin-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-(2-phenylethenyl)quinolin-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 4548738 |
| Molecular Formula | C20H20NO3S+ |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-[2-(2-phenylethenyl)quinolin-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCC[n+]1c(C=Cc2ccccc2)ccc2ccccc21 |
| InChI | InChI=1S/C20H19NO3S/c22-25(23,24)16-6-15-21-19(13-11-17-7-2-1-3-8-17)14-12-18-9-4-5-10-20(18)21/h1-5,7-14H,6,15-16H2/p+1 |
| InChIKey | QXTSSCNJEVORLP-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 58.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|