C42H39N3O4S — CID 135682078
3-[2-[(E,3E)-3-[1-(N-acetylanilino)-4,6-bis(4-methylphenyl)-2-pyridinylidene]prop-1-enyl]quinolin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 135682078) has the molecular formula C42H39N3O4S and a molecular weight of 681.86 g/mol. Its IUPAC name is 3-[2-[(E,3E)-3-[1-(N-acetylanilino)-4,6-bis(4-methylphenyl)-2-pyridinylidene]prop-1-enyl]quinolin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(E,3E)-3-[1-(N-acetylanilino)-4,6-bis(4-methylphenyl)-2-pyridinylidene]prop-1-enyl]quinolin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 135682078 |
| Molecular Formula | C42H39N3O4S |
| Molecular Weight | 681.86 g/mol |
| Exact Mass | 681.27 |
| IUPAC Name | 3-[2-[(E,3E)-3-[1-(N-acetylanilino)-4,6-bis(4-methylphenyl)-2-pyridinylidene]prop-1-enyl]quinolin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CC(=O)N(c1ccccc1)N1C(c2ccc(C)cc2)=CC(c2ccc(C)cc2)=C/C1=C\C=C\c1ccc2ccccc2[n+]1CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C42H39N3O4S/c1-31-17-21-34(22-18-31)37-29-40(15-9-14-38-26-25-35-11-7-8-16-41(35)43(38)27-10-28-50(47,48)49)45(42(30-37)36-23-19-32(2)20-24-36)44(33(3)46)39-12-5-4-6-13-39/h4-9,11-26,29-30H,10,27-28H2,1-3H3 |
| InChIKey | LRUNDAPABNFKQH-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 84.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.86 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|