C14H17NO3S — CID 3146436
3-(2,6-dimethylquinolin-1-ium-1-yl)propane-1-sulfonate (PubChem CID 3146436) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-(2,6-dimethylquinolin-1-ium-1-yl)propane-1-sulfonate.
| Compound Name | 3-(2,6-dimethylquinolin-1-ium-1-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 3146436 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-(2,6-dimethylquinolin-1-ium-1-yl)propane-1-sulfonate |
| SMILES | Cc1ccc2c(ccc(C)[n+]2CCCS(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C14H17NO3S/c1-11-4-7-14-13(10-11)6-5-12(2)15(14)8-3-9-19(16,17)18/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | XGEKMTCWSJCVBS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|