C11H18NO3S+ — CID 172878734
3-(2,4,6-trimethylpyridin-1-ium-1-yl)propane-1-sulfonic acid (PubChem CID 172878734) has the molecular formula C11H18NO3S+ and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-(2,4,6-trimethylpyridin-1-ium-1-yl)propane-1-sulfonic acid.
| Compound Name | 3-(2,4,6-trimethylpyridin-1-ium-1-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 172878734 |
| Molecular Formula | C11H18NO3S+ |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-(2,4,6-trimethylpyridin-1-ium-1-yl)propane-1-sulfonic acid |
| SMILES | Cc1cc(C)[n+](CCCS(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C11H17NO3S/c1-9-7-10(2)12(11(3)8-9)5-4-6-16(13,14)15/h7-8H,4-6H2,1-3H3/p+1 |
| InChIKey | IAKIMIPQUUJPOI-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 58.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|