C29H42NS+ — CID 166611276
6-(5-hexylthiophen-2-yl)-2-methyl-1-nonylquinolin-1-ium (PubChem CID 166611276) has the molecular formula C29H42NS+ and a molecular weight of 436.73 g/mol. Its IUPAC name is 6-(5-hexylthiophen-2-yl)-2-methyl-1-nonylquinolin-1-ium.
| Compound Name | 6-(5-hexylthiophen-2-yl)-2-methyl-1-nonylquinolin-1-ium |
|---|---|
| PubChem CID | 166611276 |
| Molecular Formula | C29H42NS+ |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 6-(5-hexylthiophen-2-yl)-2-methyl-1-nonylquinolin-1-ium |
| SMILES | CCCCCCCCC[n+]1c(C)ccc2cc(-c3ccc(CCCCCC)s3)ccc21 |
| InChI | InChI=1S/C29H42NS/c1-4-6-8-10-11-12-14-22-30-24(3)16-17-25-23-26(18-20-28(25)30)29-21-19-27(31-29)15-13-9-7-5-2/h16-21,23H,4-15,22H2,1-3H3/q+1 |
| InChIKey | MRAVFWSAGKLCPS-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|