C12H16NO3S2+ — CID 102438115
3-(2,5-dimethyl-1,3-benzothiazole-1,3-diium-3-yl)propane-1-sulfonate (PubChem CID 102438115) has the molecular formula C12H16NO3S2+ and a molecular weight of 286.40 g/mol. Its IUPAC name is 3-(2,5-dimethyl-1,3-benzothiazole-1,3-diium-3-yl)propane-1-sulfonate.
| Compound Name | 3-(2,5-dimethyl-1,3-benzothiazole-1,3-diium-3-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 102438115 |
| Molecular Formula | C12H16NO3S2+ |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-(2,5-dimethyl-1,3-benzothiazole-1,3-diium-3-yl)propane-1-sulfonate |
| SMILES | Cc1ccc2[sH+]c(C)[n+](CCCS(=O)(=O)[O-])c2c1 |
| InChI | InChI=1S/C12H15NO3S2/c1-9-4-5-12-11(8-9)13(10(2)17-12)6-3-7-18(14,15)16/h4-5,8H,3,6-7H2,1-2H3/p+1 |
| InChIKey | RHVVCHULMIKELS-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|