C12H12I3NO3S2 — CID 71736336
4-(5,6,7-triiodo-2-methyl-1,3-benzothiazol-3-ium-3-yl)butane-1-sulfonate (PubChem CID 71736336) has the molecular formula C12H12I3NO3S2 and a molecular weight of 663.08 g/mol. Its IUPAC name is 4-(5,6,7-triiodo-2-methyl-1,3-benzothiazol-3-ium-3-yl)butane-1-sulfonate.
| Compound Name | 4-(5,6,7-triiodo-2-methyl-1,3-benzothiazol-3-ium-3-yl)butane-1-sulfonate |
|---|---|
| PubChem CID | 71736336 |
| Molecular Formula | C12H12I3NO3S2 |
| Molecular Weight | 663.08 g/mol |
| Exact Mass | 662.74 |
| IUPAC Name | 4-(5,6,7-triiodo-2-methyl-1,3-benzothiazol-3-ium-3-yl)butane-1-sulfonate |
| SMILES | Cc1sc2c(I)c(I)c(I)cc2[n+]1CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H12I3NO3S2/c1-7-16(4-2-3-5-21(17,18)19)9-6-8(13)10(14)11(15)12(9)20-7/h6H,2-5H2,1H3 |
| InChIKey | WOPBFKWTFZXIHR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.08 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|