C31H30N2O5S — CID 58036086
3-[4-[5-(2-methoxy-4,5-dimethylphenyl)-1,3-oxazol-2-yl]-6-methyl-2-phenylquinolin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 58036086) has the molecular formula C31H30N2O5S and a molecular weight of 542.66 g/mol. Its IUPAC name is 3-[4-[5-(2-methoxy-4,5-dimethylphenyl)-1,3-oxazol-2-yl]-6-methyl-2-phenylquinolin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[4-[5-(2-methoxy-4,5-dimethylphenyl)-1,3-oxazol-2-yl]-6-methyl-2-phenylquinolin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 58036086 |
| Molecular Formula | C31H30N2O5S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 3-[4-[5-(2-methoxy-4,5-dimethylphenyl)-1,3-oxazol-2-yl]-6-methyl-2-phenylquinolin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | COc1cc(C)c(C)cc1-c1cnc(-c2cc(-c3ccccc3)[n+](CCCS(=O)(=O)[O-])c3ccc(C)cc23)o1 |
| InChI | InChI=1S/C31H30N2O5S/c1-20-11-12-27-24(15-20)25(31-32-19-30(38-31)26-16-21(2)22(3)17-29(26)37-4)18-28(23-9-6-5-7-10-23)33(27)13-8-14-39(34,35)36/h5-7,9-12,15-19H,8,13-14H2,1-4H3 |
| InChIKey | QRWZTSCITVETIH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 96.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|