C39H42N3O3+ — CID 23758656
N-(2-aminoethyl)-6-[2-[(E)-2-[3,4-bis(phenylmethoxy)phenyl]ethenyl]quinolin-1-ium-1-yl]hexanamide (PubChem CID 23758656) has the molecular formula C39H42N3O3+ and a molecular weight of 600.78 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[2-[(E)-2-[3,4-bis(phenylmethoxy)phenyl]ethenyl]quinolin-1-ium-1-yl]hexanamide.
| Compound Name | N-(2-aminoethyl)-6-[2-[(E)-2-[3,4-bis(phenylmethoxy)phenyl]ethenyl]quinolin-1-ium-1-yl]hexanamide |
|---|---|
| PubChem CID | 23758656 |
| Molecular Formula | C39H42N3O3+ |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | N-(2-aminoethyl)-6-[2-[(E)-2-[3,4-bis(phenylmethoxy)phenyl]ethenyl]quinolin-1-ium-1-yl]hexanamide |
| SMILES | NCCNC(=O)CCCCC[n+]1c(/C=C/c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)ccc2ccccc21 |
| InChI | InChI=1S/C39H41N3O3/c40-25-26-41-39(43)18-8-3-11-27-42-35(23-21-34-16-9-10-17-36(34)42)22-19-31-20-24-37(44-29-32-12-4-1-5-13-32)38(28-31)45-30-33-14-6-2-7-15-33/h1-2,4-7,9-10,12-17,19-24,28H,3,8,11,18,25-27,29-30,40H2/p+1/b22-19+ |
| InChIKey | REHMCGXDUUSTTJ-ZBJSNUHESA-O |
| XLogP | 7.09 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|