C25H27N2O2+ — CID 23815955
2-[2-ethenyl-6-[(E)-2-(4-methoxy-3-phenylmethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine (PubChem CID 23815955) has the molecular formula C25H27N2O2+ and a molecular weight of 387.50 g/mol. Its IUPAC name is 2-[2-ethenyl-6-[(E)-2-(4-methoxy-3-phenylmethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine.
| Compound Name | 2-[2-ethenyl-6-[(E)-2-(4-methoxy-3-phenylmethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 23815955 |
| Molecular Formula | C25H27N2O2+ |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-[2-ethenyl-6-[(E)-2-(4-methoxy-3-phenylmethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
| SMILES | C=Cc1cccc(/C=C/c2ccc(OC)c(OCc3ccccc3)c2)[n+]1CCN |
| InChI | InChI=1S/C25H27N2O2/c1-3-22-10-7-11-23(27(22)17-16-26)14-12-20-13-15-24(28-2)25(18-20)29-19-21-8-5-4-6-9-21/h3-15,18H,1,16-17,19,26H2,2H3/q+1/b14-12+ |
| InChIKey | IKXYXXHZHCZRBX-WYMLVPIESA-N |
| XLogP | 4.33 |
| TPSA | 48.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|