C29H34O3 — CID 13392879
(E)-1-[3,4-bis(phenylmethoxy)phenyl]non-1-en-3-ol (PubChem CID 13392879) has the molecular formula C29H34O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is (E)-1-[3,4-bis(phenylmethoxy)phenyl]non-1-en-3-ol.
| Compound Name | (E)-1-[3,4-bis(phenylmethoxy)phenyl]non-1-en-3-ol |
|---|---|
| PubChem CID | 13392879 |
| Molecular Formula | C29H34O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (E)-1-[3,4-bis(phenylmethoxy)phenyl]non-1-en-3-ol |
| SMILES | CCCCCCC(O)/C=C/c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H34O3/c1-2-3-4-11-16-27(30)19-17-24-18-20-28(31-22-25-12-7-5-8-13-25)29(21-24)32-23-26-14-9-6-10-15-26/h5-10,12-15,17-21,27,30H,2-4,11,16,22-23H2,1H3/b19-17+ |
| InChIKey | KPJRAGCPLVEAKB-HTXNQAPBSA-N |
| XLogP | 7.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|