C30H35N4O+ — CID 145074565
6-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)-N-(3-methylbut-3-enyl)hexanamide (PubChem CID 145074565) has the molecular formula C30H35N4O+ and a molecular weight of 467.64 g/mol. Its IUPAC name is 6-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)-N-(3-methylbut-3-enyl)hexanamide.
| Compound Name | 6-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)-N-(3-methylbut-3-enyl)hexanamide |
|---|---|
| PubChem CID | 145074565 |
| Molecular Formula | C30H35N4O+ |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 6-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)-N-(3-methylbut-3-enyl)hexanamide |
| SMILES | C=C(C)CCNC(=O)CCCCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21 |
| InChI | InChI=1S/C30H34N4O/c1-21(2)16-17-33-29(35)11-7-4-8-18-34-28-20-24(32)13-15-26(28)25-14-12-23(31)19-27(25)30(34)22-9-5-3-6-10-22/h3,5-6,9-10,12-15,19-20,32H,1,4,7-8,11,16-18,31H2,2H3,(H,33,35)/p+1 |
| InChIKey | ARBVFMSQDZMIFP-UHFFFAOYSA-O |
| XLogP | 5.75 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|