C23H22ClN5O2 — CID 11212730
[3-(carbamoylamino)-5-ethyl-6-phenylphenanthridin-5-ium-8-yl]urea chloride (PubChem CID 11212730) has the molecular formula C23H22ClN5O2 and a molecular weight of 435.92 g/mol. Its IUPAC name is [3-(carbamoylamino)-5-ethyl-6-phenylphenanthridin-5-ium-8-yl]urea chloride.
| Compound Name | [3-(carbamoylamino)-5-ethyl-6-phenylphenanthridin-5-ium-8-yl]urea chloride |
|---|---|
| PubChem CID | 11212730 |
| Molecular Formula | C23H22ClN5O2 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | [3-(carbamoylamino)-5-ethyl-6-phenylphenanthridin-5-ium-8-yl]urea chloride |
| SMILES | CC[n+]1c(-c2ccccc2)c2cc(NC(N)=O)ccc2c2ccc(NC(N)=O)cc21.[Cl-] |
| InChI | InChI=1S/C23H21N5O2.ClH/c1-2-28-20-13-16(27-23(25)30)9-11-18(20)17-10-8-15(26-22(24)29)12-19(17)21(28)14-6-4-3-5-7-14;/h3-13H,2H2,1H3,(H5,24,25,26,29,30);1H |
| InChIKey | QWBZYYCJPFKHFJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|