C24H23ClN4O2 — CID 24841101
N-[3-acetamido-6-(4-aminophenyl)-5-methylphenanthridin-5-ium-8-yl]acetamide chloride (PubChem CID 24841101) has the molecular formula C24H23ClN4O2 and a molecular weight of 434.93 g/mol. Its IUPAC name is N-[3-acetamido-6-(4-aminophenyl)-5-methylphenanthridin-5-ium-8-yl]acetamide chloride.
| Compound Name | N-[3-acetamido-6-(4-aminophenyl)-5-methylphenanthridin-5-ium-8-yl]acetamide chloride |
|---|---|
| PubChem CID | 24841101 |
| Molecular Formula | C24H23ClN4O2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[3-acetamido-6-(4-aminophenyl)-5-methylphenanthridin-5-ium-8-yl]acetamide chloride |
| SMILES | CC(=O)Nc1ccc2c(c1)c(-c1ccc(N)cc1)[n+](C)c1cc(NC(C)=O)ccc21.[Cl-] |
| InChI | InChI=1S/C24H22N4O2.ClH/c1-14(29)26-18-8-10-20-21-11-9-19(27-15(2)30)13-23(21)28(3)24(22(20)12-18)16-4-6-17(25)7-5-16;/h4-13H,1-3H3,(H3,25,26,27,29,30);1H |
| InChIKey | IGHLNEOVIXXYKJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|