C16H17N3O5S — CID 173224592
N-(9-amino-10-methylacridin-10-ium-2-yl)acetamide;hydrogen sulfate (PubChem CID 173224592) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is N-(9-amino-10-methylacridin-10-ium-2-yl)acetamide;hydrogen sulfate.
| Compound Name | N-(9-amino-10-methylacridin-10-ium-2-yl)acetamide;hydrogen sulfate |
|---|---|
| PubChem CID | 173224592 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-(9-amino-10-methylacridin-10-ium-2-yl)acetamide;hydrogen sulfate |
| SMILES | CC(=O)Nc1ccc2c(c1)c(N)c1ccccc1[n+]2C.O=S(=O)([O-])O |
| InChI | InChI=1S/C16H15N3O.H2O4S/c1-10(20)18-11-7-8-15-13(9-11)16(17)12-5-3-4-6-14(12)19(15)2;1-5(2,3)4/h3-9,17H,1-2H3,(H,18,20);(H2,1,2,3,4) |
| InChIKey | AZIHJYFGIKYAGH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|