C14H16FN3O5S2 — CID 70210987
benzenesulfonamide;N-(3-fluoro-4-sulfamoylphenyl)acetamide (PubChem CID 70210987) has the molecular formula C14H16FN3O5S2 and a molecular weight of 389.43 g/mol. Its IUPAC name is benzenesulfonamide;N-(3-fluoro-4-sulfamoylphenyl)acetamide.
| Compound Name | benzenesulfonamide;N-(3-fluoro-4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 70210987 |
| Molecular Formula | C14H16FN3O5S2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | benzenesulfonamide;N-(3-fluoro-4-sulfamoylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(S(N)(=O)=O)c(F)c1.NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C8H9FN2O3S.C6H7NO2S/c1-5(12)11-6-2-3-8(7(9)4-6)15(10,13)14;7-10(8,9)6-4-2-1-3-5-6/h2-4H,1H3,(H,11,12)(H2,10,13,14);1-5H,(H2,7,8,9) |
| InChIKey | GWKSDHKADOKQLI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |