C19H23N2O6S+ — CID 24841175
ethyl N-(5,6-dimethylphenanthridin-5-ium-8-yl)carbamate;methyl hydrogen sulfate (PubChem CID 24841175) has the molecular formula C19H23N2O6S+ and a molecular weight of 407.47 g/mol. Its IUPAC name is ethyl N-(5,6-dimethylphenanthridin-5-ium-8-yl)carbamate;methyl hydrogen sulfate.
| Compound Name | ethyl N-(5,6-dimethylphenanthridin-5-ium-8-yl)carbamate;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 24841175 |
| Molecular Formula | C19H23N2O6S+ |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | ethyl N-(5,6-dimethylphenanthridin-5-ium-8-yl)carbamate;methyl hydrogen sulfate |
| SMILES | CCOC(=O)Nc1ccc2c(c1)c(C)[n+](C)c1ccccc21.COS(=O)(=O)O |
| InChI | InChI=1S/C18H18N2O2.CH4O4S/c1-4-22-18(21)19-13-9-10-14-15-7-5-6-8-17(15)20(3)12(2)16(14)11-13;1-5-6(2,3)4/h5-11H,4H2,1-3H3;1H3,(H,2,3,4)/p+1 |
| InChIKey | IRNBVKGLDAPFGF-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|