C18H17N2+ — CID 102464720
5,6-dimethyl-N-prop-2-ynylphenanthridin-5-ium-8-amine (PubChem CID 102464720) has the molecular formula C18H17N2+ and a molecular weight of 261.35 g/mol. Its IUPAC name is 5,6-dimethyl-N-prop-2-ynylphenanthridin-5-ium-8-amine.
| Compound Name | 5,6-dimethyl-N-prop-2-ynylphenanthridin-5-ium-8-amine |
|---|---|
| PubChem CID | 102464720 |
| Molecular Formula | C18H17N2+ |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 5,6-dimethyl-N-prop-2-ynylphenanthridin-5-ium-8-amine |
| SMILES | C#CCNc1ccc2c(c1)c(C)[n+](C)c1ccccc21 |
| InChI | InChI=1S/C18H17N2/c1-4-11-19-14-9-10-15-16-7-5-6-8-18(16)20(3)13(2)17(15)12-14/h1,5-10,12,19H,11H2,2-3H3/q+1 |
| InChIKey | GVMDTPLLZDMTNM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|