C17H18N+ — CID 160890914
2,3,5,6-tetramethylphenanthridin-5-ium (PubChem CID 160890914) has the molecular formula C17H18N+ and a molecular weight of 236.34 g/mol. Its IUPAC name is 2,3,5,6-tetramethylphenanthridin-5-ium.
| Compound Name | 2,3,5,6-tetramethylphenanthridin-5-ium |
|---|---|
| PubChem CID | 160890914 |
| Molecular Formula | C17H18N+ |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2,3,5,6-tetramethylphenanthridin-5-ium |
| SMILES | Cc1cc2c3ccccc3c(C)[n+](C)c2cc1C |
| InChI | InChI=1S/C17H18N/c1-11-9-16-15-8-6-5-7-14(15)13(3)18(4)17(16)10-12(11)2/h5-10H,1-4H3/q+1 |
| InChIKey | XYGCZGWEBSUGHZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|