C11H11IN+ — CID 121219161
4-iodo-1,2-dimethylquinolin-1-ium (PubChem CID 121219161) has the molecular formula C11H11IN+ and a molecular weight of 284.12 g/mol. Its IUPAC name is 4-iodo-1,2-dimethylquinolin-1-ium.
| Compound Name | 4-iodo-1,2-dimethylquinolin-1-ium |
|---|---|
| PubChem CID | 121219161 |
| Molecular Formula | C11H11IN+ |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 4-iodo-1,2-dimethylquinolin-1-ium |
| SMILES | Cc1cc(I)c2ccccc2[n+]1C |
| InChI | InChI=1S/C11H11IN/c1-8-7-10(12)9-5-3-4-6-11(9)13(8)2/h3-7H,1-2H3/q+1 |
| InChIKey | MITSWTONWLCVRH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|