C12H14NO+ — CID 3299774
4-methoxy-1,2-dimethylquinolin-1-ium (PubChem CID 3299774) has the molecular formula C12H14NO+ and a molecular weight of 188.25 g/mol. Its IUPAC name is 4-methoxy-1,2-dimethylquinolin-1-ium.
| Compound Name | 4-methoxy-1,2-dimethylquinolin-1-ium |
|---|---|
| PubChem CID | 3299774 |
| Molecular Formula | C12H14NO+ |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4-methoxy-1,2-dimethylquinolin-1-ium |
| SMILES | COc1cc(C)[n+](C)c2ccccc12 |
| InChI | InChI=1S/C12H14NO/c1-9-8-12(14-3)10-6-4-5-7-11(10)13(9)2/h4-8H,1-3H3/q+1 |
| InChIKey | RYAWCTLLXAKAGY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|