C22H21N2O2+ — CID 164609477
N-(2,4-dimethoxyphenyl)-10-methylacridin-10-ium-9-amine (PubChem CID 164609477) has the molecular formula C22H21N2O2+ and a molecular weight of 345.42 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-10-methylacridin-10-ium-9-amine.
| Compound Name | N-(2,4-dimethoxyphenyl)-10-methylacridin-10-ium-9-amine |
|---|---|
| PubChem CID | 164609477 |
| Molecular Formula | C22H21N2O2+ |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-10-methylacridin-10-ium-9-amine |
| SMILES | COc1ccc(Nc2c3ccccc3[n+](C)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C22H20N2O2/c1-24-19-10-6-4-8-16(19)22(17-9-5-7-11-20(17)24)23-18-13-12-15(25-2)14-21(18)26-3/h4-14H,1-3H3/p+1 |
| InChIKey | CIXDPWWHBOWBCF-UHFFFAOYSA-O |
| XLogP | 4.58 |
| TPSA | 34.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|