C19H21N2O2+ — CID 5034037
N-(2,4-dimethoxyphenyl)-2,8-dimethylquinolin-1-ium-4-amine (PubChem CID 5034037) has the molecular formula C19H21N2O2+ and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2,8-dimethylquinolin-1-ium-4-amine.
| Compound Name | N-(2,4-dimethoxyphenyl)-2,8-dimethylquinolin-1-ium-4-amine |
|---|---|
| PubChem CID | 5034037 |
| Molecular Formula | C19H21N2O2+ |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2,8-dimethylquinolin-1-ium-4-amine |
| SMILES | COc1ccc(Nc2cc(C)[nH+]c3c(C)cccc23)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O2/c1-12-6-5-7-15-17(10-13(2)20-19(12)15)21-16-9-8-14(22-3)11-18(16)23-4/h5-11H,1-4H3,(H,20,21)/p+1 |
| InChIKey | FERBQJVRPHTIHD-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 44.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |