C17H17N2O+ — CID 1391620
4-[(2,8-dimethylquinolin-1-ium-4-yl)amino]phenol (PubChem CID 1391620) has the molecular formula C17H17N2O+ and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-[(2,8-dimethylquinolin-1-ium-4-yl)amino]phenol.
| Compound Name | 4-[(2,8-dimethylquinolin-1-ium-4-yl)amino]phenol |
|---|---|
| PubChem CID | 1391620 |
| Molecular Formula | C17H17N2O+ |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-[(2,8-dimethylquinolin-1-ium-4-yl)amino]phenol |
| SMILES | Cc1cc(Nc2ccc(O)cc2)c2cccc(C)c2[nH+]1 |
| InChI | InChI=1S/C17H16N2O/c1-11-4-3-5-15-16(10-12(2)18-17(11)15)19-13-6-8-14(20)9-7-13/h3-10,20H,1-2H3,(H,18,19)/p+1 |
| InChIKey | LVKJOEZNXMUDOL-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|