About 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride
6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride (PubChem CID 10829802) has the molecular formula C16H15Cl2NO2
and a molecular weight of 324.21 g/mol. Its IUPAC name is 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride.
Molecular Properties
| Compound Name | 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride |
| PubChem CID | 10829802 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride |
| SMILES | COc1cc(Cl)c2[n+](C)c3ccccc3c-2cc1OC.[Cl-] |
| InChI | InChI=1S/C16H15ClNO2.ClH/c1-18-13-7-5-4-6-10(13)11-8-14(19-2)15(20-3)9-12(17)16(11)18;/h4-9H,1-3H3;1H/q+1;/p-1 |
| InChIKey | AYAXNTZBDIFXGK-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride?
The IUPAC name of 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride (CID 10829802) is 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride.
What is the SMILES notation for 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride?
The canonical SMILES for 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride is COc1cc(Cl)c2[n+](C)c3ccccc3c-2cc1OC.[Cl-].
What is the InChIKey of 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride?
The InChIKey is AYAXNTZBDIFXGK-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H15ClNO2.ClH/c1-18-13-7-5-4-6-10(13)11-8-14(19-2)15(20-3)9-12(17)16(11)18;/h4-9H,1-3H3;1H/q+1;/p-1.
What are the key properties of 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride?
6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride has a molecular weight of 324.21 g/mol, XLogP of 0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride is sourced from PubChem (CID 10829802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).