C16H15Cl2NO2 — CID 10829802
6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride (PubChem CID 10829802) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride.
| Compound Name | 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride |
|---|---|
| PubChem CID | 10829802 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 6-chloro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium chloride |
| SMILES | COc1cc(Cl)c2[n+](C)c3ccccc3c-2cc1OC.[Cl-] |
| InChI | InChI=1S/C16H15ClNO2.ClH/c1-18-13-7-5-4-6-10(13)11-8-14(19-2)15(20-3)9-12(17)16(11)18;/h4-9H,1-3H3;1H/q+1;/p-1 |
| InChIKey | AYAXNTZBDIFXGK-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|