C23H21Cl2NO3 — CID 139809951
6-chloro-8,9-dimethoxy-5-methyl-4-phenylmethoxycyclohepta[b]indol-5-ium chloride (PubChem CID 139809951) has the molecular formula C23H21Cl2NO3 and a molecular weight of 430.33 g/mol. Its IUPAC name is 6-chloro-8,9-dimethoxy-5-methyl-4-phenylmethoxycyclohepta[b]indol-5-ium chloride.
| Compound Name | 6-chloro-8,9-dimethoxy-5-methyl-4-phenylmethoxycyclohepta[b]indol-5-ium chloride |
|---|---|
| PubChem CID | 139809951 |
| Molecular Formula | C23H21Cl2NO3 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 6-chloro-8,9-dimethoxy-5-methyl-4-phenylmethoxycyclohepta[b]indol-5-ium chloride |
| SMILES | COc1cc(Cl)c2[n+](C)c3c(OCc4ccccc4)cccc3c-2cc1OC.[Cl-] |
| InChI | InChI=1S/C23H21ClNO3.ClH/c1-25-22-17(12-20(26-2)21(27-3)13-18(22)24)16-10-7-11-19(23(16)25)28-14-15-8-5-4-6-9-15;/h4-13H,14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XMYCSSVVSQPDLP-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|