C16H14ClFNO2+ — CID 139810082
6-chloro-1-fluoro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium (PubChem CID 139810082) has the molecular formula C16H14ClFNO2+ and a molecular weight of 306.74 g/mol. Its IUPAC name is 6-chloro-1-fluoro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium.
| Compound Name | 6-chloro-1-fluoro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium |
|---|---|
| PubChem CID | 139810082 |
| Molecular Formula | C16H14ClFNO2+ |
| Molecular Weight | 306.74 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 6-chloro-1-fluoro-8,9-dimethoxy-5-methylcyclohepta[b]indol-5-ium |
| SMILES | COc1cc(Cl)c2[n+](C)c3cccc(F)c3c-2cc1OC |
| InChI | InChI=1S/C16H14ClFNO2/c1-19-12-6-4-5-11(18)15(12)9-7-13(20-2)14(21-3)8-10(17)16(9)19/h4-8H,1-3H3/q+1 |
| InChIKey | XVYRMXOZIZVMNT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.74 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|