C23H22N3O2+ — CID 24841100
ethyl N-[6-(4-aminophenyl)-5-methylphenanthridin-5-ium-3-yl]carbamate (PubChem CID 24841100) has the molecular formula C23H22N3O2+ and a molecular weight of 372.45 g/mol. Its IUPAC name is ethyl N-[6-(4-aminophenyl)-5-methylphenanthridin-5-ium-3-yl]carbamate.
| Compound Name | ethyl N-[6-(4-aminophenyl)-5-methylphenanthridin-5-ium-3-yl]carbamate |
|---|---|
| PubChem CID | 24841100 |
| Molecular Formula | C23H22N3O2+ |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | ethyl N-[6-(4-aminophenyl)-5-methylphenanthridin-5-ium-3-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c3ccccc3c(-c3ccc(N)cc3)[n+](C)c2c1 |
| InChI | InChI=1S/C23H21N3O2/c1-3-28-23(27)25-17-12-13-19-18-6-4-5-7-20(18)22(26(2)21(19)14-17)15-8-10-16(24)11-9-15/h4-14H,3H2,1-2H3,(H2,24,25,27)/p+1 |
| InChIKey | LQRXJDSNTVYLBL-UHFFFAOYSA-O |
| XLogP | 4.64 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|