C29H26N3O2+ — CID 102217709
benzyl N-(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-8-yl)carbamate (PubChem CID 102217709) has the molecular formula C29H26N3O2+ and a molecular weight of 448.55 g/mol. Its IUPAC name is benzyl N-(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-8-yl)carbamate.
| Compound Name | benzyl N-(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-8-yl)carbamate |
|---|---|
| PubChem CID | 102217709 |
| Molecular Formula | C29H26N3O2+ |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | benzyl N-(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-8-yl)carbamate |
| SMILES | CC[n+]1c(-c2ccccc2)c2cc(NC(=O)OCc3ccccc3)ccc2c2ccc(N)cc21 |
| InChI | InChI=1S/C29H25N3O2/c1-2-32-27-17-22(30)13-15-25(27)24-16-14-23(18-26(24)28(32)21-11-7-4-8-12-21)31-29(33)34-19-20-9-5-3-6-10-20/h3-18,30H,2,19H2,1H3,(H,31,33)/p+1 |
| InChIKey | LCVUNTXFZQMPCD-UHFFFAOYSA-O |
| XLogP | 6.30 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|