C21H22N6 — CID 171374493
5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;hydrazinylideneazanide (PubChem CID 171374493) has the molecular formula C21H22N6 and a molecular weight of 358.45 g/mol. Its IUPAC name is 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;hydrazinylideneazanide.
| Compound Name | 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;hydrazinylideneazanide |
|---|---|
| PubChem CID | 171374493 |
| Molecular Formula | C21H22N6 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;hydrazinylideneazanide |
| SMILES | CC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21.[N-]=NN |
| InChI | InChI=1S/C21H19N3.H2N3/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;1-3-2/h3-13,23H,2,22H2,1H3;(H2-,1,2)/q;-1/p+1 |
| InChIKey | GEANBTNAAAOAOY-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|