C23H22N3+ — CID 169189469
5-but-3-enyl-6-phenylphenanthridin-5-ium-3,8-diamine (PubChem CID 169189469) has the molecular formula C23H22N3+ and a molecular weight of 340.45 g/mol. Its IUPAC name is 5-but-3-enyl-6-phenylphenanthridin-5-ium-3,8-diamine.
| Compound Name | 5-but-3-enyl-6-phenylphenanthridin-5-ium-3,8-diamine |
|---|---|
| PubChem CID | 169189469 |
| Molecular Formula | C23H22N3+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 5-but-3-enyl-6-phenylphenanthridin-5-ium-3,8-diamine |
| SMILES | C=CCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21 |
| InChI | InChI=1S/C23H21N3/c1-2-3-13-26-22-15-18(25)10-12-20(22)19-11-9-17(24)14-21(19)23(26)16-7-5-4-6-8-16/h2,4-12,14-15,25H,1,3,13,24H2/p+1 |
| InChIKey | GWGKPLSHJAOGQR-UHFFFAOYSA-O |
| XLogP | 4.69 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|