C22H23IN3+3 — CID 20729241
[3-azaniumyl-5-(3-iodopropyl)-6-phenylphenanthridin-5-ium-8-yl]azanium (PubChem CID 20729241) has the molecular formula C22H23IN3+3 and a molecular weight of 456.35 g/mol. Its IUPAC name is [3-azaniumyl-5-(3-iodopropyl)-6-phenylphenanthridin-5-ium-8-yl]azanium.
| Compound Name | [3-azaniumyl-5-(3-iodopropyl)-6-phenylphenanthridin-5-ium-8-yl]azanium |
|---|---|
| PubChem CID | 20729241 |
| Molecular Formula | C22H23IN3+3 |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | [3-azaniumyl-5-(3-iodopropyl)-6-phenylphenanthridin-5-ium-8-yl]azanium |
| SMILES | [NH3+]c1ccc2c(c1)c(-c1ccccc1)[n+](CCCI)c1cc([NH3+])ccc21 |
| InChI | InChI=1S/C22H20IN3/c23-11-4-12-26-21-14-17(25)8-10-19(21)18-9-7-16(24)13-20(18)22(26)15-5-2-1-3-6-15/h1-3,5-10,13-14,25H,4,11-12,24H2/p+3 |
| InChIKey | ZERJICWOBZXLAQ-UHFFFAOYSA-Q |
| XLogP | 3.52 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|