C23H26N3+ — CID 90961020
5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine;propane (PubChem CID 90961020) has the molecular formula C23H26N3+ and a molecular weight of 344.48 g/mol. Its IUPAC name is 5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine;propane.
| Compound Name | 5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine;propane |
|---|---|
| PubChem CID | 90961020 |
| Molecular Formula | C23H26N3+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine;propane |
| SMILES | CCC.C[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21 |
| InChI | InChI=1S/C20H17N3.C3H8/c1-23-19-12-15(22)8-10-17(19)16-9-7-14(21)11-18(16)20(23)13-5-3-2-4-6-13;1-3-2/h2-12,22H,21H2,1H3;3H2,1-2H3/p+1 |
| InChIKey | YATXXQVRACCSBF-UHFFFAOYSA-O |
| XLogP | 5.07 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|