C48H50BrN6O2+ — CID 54612239
6-[3-[8-[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)phenoxy]octoxy]phenyl]-5-methylphenanthridin-5-ium-3,8-diamine bromide (PubChem CID 54612239) has the molecular formula C48H50BrN6O2+ and a molecular weight of 822.87 g/mol. Its IUPAC name is 6-[3-[8-[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)phenoxy]octoxy]phenyl]-5-methylphenanthridin-5-ium-3,8-diamine bromide.
| Compound Name | 6-[3-[8-[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)phenoxy]octoxy]phenyl]-5-methylphenanthridin-5-ium-3,8-diamine bromide |
|---|---|
| PubChem CID | 54612239 |
| Molecular Formula | C48H50BrN6O2+ |
| Molecular Weight | 822.87 g/mol |
| Exact Mass | 821.32 |
| IUPAC Name | 6-[3-[8-[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)phenoxy]octoxy]phenyl]-5-methylphenanthridin-5-ium-3,8-diamine bromide |
| SMILES | C[n+]1c(-c2cccc(OCCCCCCCCOc3cccc(-c4c5cc(N)ccc5c5ccc(N)cc5[n+]4C)c3)c2)c2cc(N)ccc2c2ccc(N)cc21.[Br-] |
| InChI | InChI=1S/C48H48N6O2.BrH/c1-53-45-29-35(51)17-21-41(45)39-19-15-33(49)27-43(39)47(53)31-11-9-13-37(25-31)55-23-7-5-3-4-6-8-24-56-38-14-10-12-32(26-38)48-44-28-34(50)16-20-40(44)42-22-18-36(52)30-46(42)54(48)2;/h9-22,25-30,51-52H,3-8,23-24,49-50H2,1-2H3;1H/p+1 |
| InChIKey | QCBILYNUJBEYCT-UHFFFAOYSA-O |
| XLogP | 6.41 |
| TPSA | 130.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.87 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|