C28H36I2N4 — CID 69205294
3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-triethylazanium diiodide (PubChem CID 69205294) has the molecular formula C28H36I2N4 and a molecular weight of 682.43 g/mol. Its IUPAC name is 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-triethylazanium diiodide.
| Compound Name | 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-triethylazanium diiodide |
|---|---|
| PubChem CID | 69205294 |
| Molecular Formula | C28H36I2N4 |
| Molecular Weight | 682.43 g/mol |
| Exact Mass | 682.10 |
| IUPAC Name | 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-triethylazanium diiodide |
| SMILES | CC[N+](CC)(CC)CCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21.[I-].[I-] |
| InChI | InChI=1S/C28H35N4.2HI/c1-4-32(5-2,6-3)18-10-17-31-27-20-23(30)14-16-25(27)24-15-13-22(29)19-26(24)28(31)21-11-8-7-9-12-21;;/h7-9,11-16,19-20,30H,4-6,10,17-18,29H2,1-3H3;2*1H/q+1;;/p-1 |
| InChIKey | JZVLVMYGXNSVMS-UHFFFAOYSA-M |
| XLogP | -0.61 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.43 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|