C23H22N+ — CID 18730678
5-ethyl-3,8-dimethyl-6-phenylphenanthridin-5-ium (PubChem CID 18730678) has the molecular formula C23H22N+ and a molecular weight of 312.44 g/mol. Its IUPAC name is 5-ethyl-3,8-dimethyl-6-phenylphenanthridin-5-ium.
| Compound Name | 5-ethyl-3,8-dimethyl-6-phenylphenanthridin-5-ium |
|---|---|
| PubChem CID | 18730678 |
| Molecular Formula | C23H22N+ |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 5-ethyl-3,8-dimethyl-6-phenylphenanthridin-5-ium |
| SMILES | CC[n+]1c(-c2ccccc2)c2cc(C)ccc2c2ccc(C)cc21 |
| InChI | InChI=1S/C23H22N/c1-4-24-22-15-17(3)11-13-20(22)19-12-10-16(2)14-21(19)23(24)18-8-6-5-7-9-18/h5-15H,4H2,1-3H3/q+1 |
| InChIKey | YWYPNXYOEJTZMB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|