C21H20BrHgN3+2 — CID 67510032
5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;mercury(2+);bromide (PubChem CID 67510032) has the molecular formula C21H20BrHgN3+2 and a molecular weight of 594.91 g/mol. Its IUPAC name is 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;mercury(2+);bromide.
| Compound Name | 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;mercury(2+);bromide |
|---|---|
| PubChem CID | 67510032 |
| Molecular Formula | C21H20BrHgN3+2 |
| Molecular Weight | 594.91 g/mol |
| Exact Mass | 595.05 |
| IUPAC Name | 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;mercury(2+);bromide |
| SMILES | CC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21.[Br-].[Hg+2] |
| InChI | InChI=1S/C21H19N3.BrH.Hg/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;;/h3-13,23H,2,22H2,1H3;1H;/q;;+2 |
| InChIKey | KJZOLBGSKVHNDE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.91 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|