C35H52N5O2+ — CID 145074574
6-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)hexanamide;3-methylbutan-1-amine;3-methylbutan-1-ol (PubChem CID 145074574) has the molecular formula C35H52N5O2+ and a molecular weight of 574.83 g/mol. Its IUPAC name is 6-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)hexanamide;3-methylbutan-1-amine;3-methylbutan-1-ol.
| Compound Name | 6-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)hexanamide;3-methylbutan-1-amine;3-methylbutan-1-ol |
|---|---|
| PubChem CID | 145074574 |
| Molecular Formula | C35H52N5O2+ |
| Molecular Weight | 574.83 g/mol |
| Exact Mass | 574.41 |
| IUPAC Name | 6-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)hexanamide;3-methylbutan-1-amine;3-methylbutan-1-ol |
| SMILES | CC(C)CCN.CC(C)CCO.NC(=O)CCCCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21 |
| InChI | InChI=1S/C25H26N4O.C5H13N.C5H12O/c26-18-10-12-20-21-13-11-19(27)16-23(21)29(14-6-2-5-9-24(28)30)25(22(20)15-18)17-7-3-1-4-8-17;2*1-5(2)3-4-6/h1,3-4,7-8,10-13,15-16,27H,2,5-6,9,14,26H2,(H2,28,30);5H,3-4,6H2,1-2H3;5-6H,3-4H2,1-2H3/p+1 |
| InChIKey | WTLIHOKEKXEVRQ-UHFFFAOYSA-O |
| XLogP | 6.17 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.83 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|