C38H43F3N6O2+2 — CID 163953778
2-(2-aminobutanoylamino)ethyl-[4-[4-[(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)methyl]phenyl]-4-oxobutyl]-methyl-(trifluoromethyl)azanium (PubChem CID 163953778) has the molecular formula C38H43F3N6O2+2 and a molecular weight of 672.80 g/mol. Its IUPAC name is 2-(2-aminobutanoylamino)ethyl-[4-[4-[(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)methyl]phenyl]-4-oxobutyl]-methyl-(trifluoromethyl)azanium.
| Compound Name | 2-(2-aminobutanoylamino)ethyl-[4-[4-[(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)methyl]phenyl]-4-oxobutyl]-methyl-(trifluoromethyl)azanium |
|---|---|
| PubChem CID | 163953778 |
| Molecular Formula | C38H43F3N6O2+2 |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | 2-(2-aminobutanoylamino)ethyl-[4-[4-[(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)methyl]phenyl]-4-oxobutyl]-methyl-(trifluoromethyl)azanium |
| SMILES | CCC(N)C(=O)NCC[N+](C)(CCCC(=O)c1ccc(C[n+]2c(-c3ccccc3)c3cc(N)ccc3c3ccc(N)cc32)cc1)C(F)(F)F |
| InChI | InChI=1S/C38H41F3N6O2/c1-3-33(44)37(49)45-19-21-47(2,38(39,40)41)20-7-10-35(48)26-13-11-25(12-14-26)24-46-34-23-29(43)16-18-31(34)30-17-15-28(42)22-32(30)36(46)27-8-5-4-6-9-27/h4-6,8-9,11-18,22-23,33,43H,3,7,10,19-21,24,42,44H2,1-2H3/p+2 |
| InChIKey | KIBBIOITZBWXTI-UHFFFAOYSA-P |
| XLogP | 5.94 |
| TPSA | 128.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|