C41H58N8O6+2 — CID 134530835
2-[3-[2-[2-[2-[2-[6-(8-amino-3-azido-6-phenylphenanthridin-5-ium-5-yl)hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]ethyl-trimethylazanium (PubChem CID 134530835) has the molecular formula C41H58N8O6+2 and a molecular weight of 758.96 g/mol. Its IUPAC name is 2-[3-[2-[2-[2-[2-[6-(8-amino-3-azido-6-phenylphenanthridin-5-ium-5-yl)hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]ethyl-trimethylazanium.
| Compound Name | 2-[3-[2-[2-[2-[2-[6-(8-amino-3-azido-6-phenylphenanthridin-5-ium-5-yl)hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 134530835 |
| Molecular Formula | C41H58N8O6+2 |
| Molecular Weight | 758.96 g/mol |
| Exact Mass | 758.45 |
| IUPAC Name | 2-[3-[2-[2-[2-[2-[6-(8-amino-3-azido-6-phenylphenanthridin-5-ium-5-yl)hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCNC(=O)CCOCCOCCOCCOCCNC(=O)CCCCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N=[N+]=[N-])cc21 |
| InChI | InChI=1S/C41H56N8O6/c1-49(2,3)21-18-44-40(51)17-22-52-24-26-54-28-29-55-27-25-53-23-19-45-39(50)12-8-5-9-20-48-38-31-34(46-47-43)14-16-36(38)35-15-13-33(42)30-37(35)41(48)32-10-6-4-7-11-32/h4,6-7,10-11,13-16,30-31H,5,8-9,12,17-29,42H2,1-3H3/p+2 |
| InChIKey | LBOONOVDWHYHBX-UHFFFAOYSA-P |
| XLogP | 5.43 |
| TPSA | 173.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.96 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|