C47H46Cl2N8O2 — CID 140538194
2,2-bis(2-aminoethyl)-1,3-bis[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)phenyl]propane-1,3-dione dichloride (PubChem CID 140538194) has the molecular formula C47H46Cl2N8O2 and a molecular weight of 825.85 g/mol. Its IUPAC name is 2,2-bis(2-aminoethyl)-1,3-bis[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)phenyl]propane-1,3-dione dichloride.
| Compound Name | 2,2-bis(2-aminoethyl)-1,3-bis[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)phenyl]propane-1,3-dione dichloride |
|---|---|
| PubChem CID | 140538194 |
| Molecular Formula | C47H46Cl2N8O2 |
| Molecular Weight | 825.85 g/mol |
| Exact Mass | 824.31 |
| IUPAC Name | 2,2-bis(2-aminoethyl)-1,3-bis[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)phenyl]propane-1,3-dione dichloride |
| SMILES | C[n+]1c(-c2cccc(C(=O)C(CCN)(CCN)C(=O)c3cccc(-c4c5cc(N)ccc5c5ccc(N)cc5[n+]4C)c3)c2)c2cc(N)ccc2c2ccc(N)cc21.[Cl-].[Cl-] |
| InChI | InChI=1S/C47H44N8O2.2ClH/c1-54-41-25-33(52)11-15-37(41)35-13-9-31(50)23-39(35)43(54)27-5-3-7-29(21-27)45(56)47(17-19-48,18-20-49)46(57)30-8-4-6-28(22-30)44-40-24-32(51)10-14-36(40)38-16-12-34(53)26-42(38)55(44)2;;/h3-16,21-26,52-53H,17-20,48-51H2,1-2H3;2*1H |
| InChIKey | WUHLUCBTXYJXTE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 198.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.85 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|